C22H38O6 — CID 134937712
methyl (5Z,8R,9R,10E,12S)-12-acetyloxy-8,9-bis(hydroxymethyl)heptadeca-5,10-dienoate (PubChem CID 134937712) has the molecular formula C22H38O6 and a molecular weight of 398.54 g/mol. Its IUPAC name is methyl (5Z,8R,9R,10E,12S)-12-acetyloxy-8,9-bis(hydroxymethyl)heptadeca-5,10-dienoate.
| Compound Name | methyl (5Z,8R,9R,10E,12S)-12-acetyloxy-8,9-bis(hydroxymethyl)heptadeca-5,10-dienoate |
|---|---|
| PubChem CID | 134937712 |
| Molecular Formula | C22H38O6 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | methyl (5Z,8R,9R,10E,12S)-12-acetyloxy-8,9-bis(hydroxymethyl)heptadeca-5,10-dienoate |
| SMILES | CCCCC[C@@H](/C=C/[C@@H](CO)C(CO)C/C=C\CCCC(=O)OC)OC(C)=O |
| InChI | InChI=1S/C22H38O6/c1-4-5-8-12-21(28-18(2)25)15-14-20(17-24)19(16-23)11-9-6-7-10-13-22(26)27-3/h6,9,14-15,19-21,23-24H,4-5,7-8,10-13,16-17H2,1-3H3/b9-6-,15-14+/t19?,20-,21-/m0/s1 |
| InChIKey | DPKOAAHKQRDSFR-MYZOCYDESA-N |
| XLogP | 3.56 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|