C20H32O2 — CID 11324173
(1R,6S,11S,12R,13R,15S)-6,12,16-trimethyl-2-methylidenetricyclo[7.5.2.012,15]hexadec-9(16)-ene-11,13-diol (PubChem CID 11324173) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (1R,6S,11S,12R,13R,15S)-6,12,16-trimethyl-2-methylidenetricyclo[7.5.2.012,15]hexadec-9(16)-ene-11,13-diol.
| Compound Name | (1R,6S,11S,12R,13R,15S)-6,12,16-trimethyl-2-methylidenetricyclo[7.5.2.012,15]hexadec-9(16)-ene-11,13-diol |
|---|---|
| PubChem CID | 11324173 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (1R,6S,11S,12R,13R,15S)-6,12,16-trimethyl-2-methylidenetricyclo[7.5.2.012,15]hexadec-9(16)-ene-11,13-diol |
| SMILES | C=C1CCC[C@H](C)CCC2=C(C)[C@@H]3[C@H]1C[C@@H](O)[C@]3(C)[C@@H](O)C2 |
| InChI | InChI=1S/C20H32O2/c1-12-6-5-7-13(2)16-11-18(22)20(4)17(21)10-15(9-8-12)14(3)19(16)20/h12,16-19,21-22H,2,5-11H2,1,3-4H3/t12-,16-,17-,18+,19+,20-/m0/s1 |
| InChIKey | FEXKLZKJWJGBAY-JHBMXPPKSA-N |
| XLogP | 4.23 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|