About [2-[2-(3,5-dimethylanilino)pyrimidin-4-yl]-1,3-thiazol-5-yl]methanol
[2-[2-(3,5-dimethylanilino)pyrimidin-4-yl]-1,3-thiazol-5-yl]methanol (PubChem CID 11324412) has the molecular formula C16H16N4OS
and a molecular weight of 312.40 g/mol. Its IUPAC name is [2-[2-(3,5-dimethylanilino)pyrimidin-4-yl]-1,3-thiazol-5-yl]methanol.
Molecular Properties
| Compound Name | [2-[2-(3,5-dimethylanilino)pyrimidin-4-yl]-1,3-thiazol-5-yl]methanol |
| PubChem CID | 11324412 |
| Molecular Formula | C16H16N4OS |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | [2-[2-(3,5-dimethylanilino)pyrimidin-4-yl]-1,3-thiazol-5-yl]methanol |
| SMILES | Cc1cc(C)cc(Nc2nccc(-c3ncc(CO)s3)n2)c1 |
| InChI | InChI=1S/C16H16N4OS/c1-10-5-11(2)7-12(6-10)19-16-17-4-3-14(20-16)15-18-8-13(9-21)22-15/h3-8,21H,9H2,1-2H3,(H,17,19,20) |
| InChIKey | XZSYGIPHRZNQNN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[2-(3,5-dimethylanilino)pyrimidin-4-yl]-1,3-thiazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2-(3,5-dimethylanilino)pyrimidin-4-yl]-1,3-thiazol-5-yl]methanol?
The IUPAC name of [2-[2-(3,5-dimethylanilino)pyrimidin-4-yl]-1,3-thiazol-5-yl]methanol (CID 11324412) is [2-[2-(3,5-dimethylanilino)pyrimidin-4-yl]-1,3-thiazol-5-yl]methanol.
What is the SMILES notation for [2-[2-(3,5-dimethylanilino)pyrimidin-4-yl]-1,3-thiazol-5-yl]methanol?
The canonical SMILES for [2-[2-(3,5-dimethylanilino)pyrimidin-4-yl]-1,3-thiazol-5-yl]methanol is Cc1cc(C)cc(Nc2nccc(-c3ncc(CO)s3)n2)c1.
What is the InChIKey of [2-[2-(3,5-dimethylanilino)pyrimidin-4-yl]-1,3-thiazol-5-yl]methanol?
The InChIKey is XZSYGIPHRZNQNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4OS/c1-10-5-11(2)7-12(6-10)19-16-17-4-3-14(20-16)15-18-8-13(9-21)22-15/h3-8,21H,9H2,1-2H3,(H,17,19,20).
What are the key properties of [2-[2-(3,5-dimethylanilino)pyrimidin-4-yl]-1,3-thiazol-5-yl]methanol?
[2-[2-(3,5-dimethylanilino)pyrimidin-4-yl]-1,3-thiazol-5-yl]methanol has a molecular weight of 312.40 g/mol, XLogP of 3.45, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2-(3,5-dimethylanilino)pyrimidin-4-yl]-1,3-thiazol-5-yl]methanol is sourced from PubChem (CID 11324412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).