C11H17F3N2O — CID 113245868
N-cyclobutyl-4-(trifluoromethyl)piperidine-1-carboxamide (PubChem CID 113245868) has the molecular formula C11H17F3N2O and a molecular weight of 250.26 g/mol. Its IUPAC name is N-cyclobutyl-4-(trifluoromethyl)piperidine-1-carboxamide.
| Compound Name | N-cyclobutyl-4-(trifluoromethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 113245868 |
| Molecular Formula | C11H17F3N2O |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | N-cyclobutyl-4-(trifluoromethyl)piperidine-1-carboxamide |
| SMILES | O=C(NC1CCC1)N1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H17F3N2O/c12-11(13,14)8-4-6-16(7-5-8)10(17)15-9-2-1-3-9/h8-9H,1-7H2,(H,15,17) |
| InChIKey | KWGKRZMGWLNPIY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |