C19H25BO5S — CID 113249363
4,4,5,5-tetramethyl-2-[2-(2-methylsulfonylethoxy)naphthalen-1-yl]-1,3,2-dioxaborolane (PubChem CID 113249363) has the molecular formula C19H25BO5S and a molecular weight of 376.28 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[2-(2-methylsulfonylethoxy)naphthalen-1-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[2-(2-methylsulfonylethoxy)naphthalen-1-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 113249363 |
| Molecular Formula | C19H25BO5S |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[2-(2-methylsulfonylethoxy)naphthalen-1-yl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2c(OCCS(C)(=O)=O)ccc3ccccc23)OC1(C)C |
| InChI | InChI=1S/C19H25BO5S/c1-18(2)19(3,4)25-20(24-18)17-15-9-7-6-8-14(15)10-11-16(17)23-12-13-26(5,21)22/h6-11H,12-13H2,1-5H3 |
| InChIKey | RMNSLAGUTXDZOK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|