C21H25BN2O2S — CID 113249741
6-methyl-2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylsulfanyl]-1H-benzimidazole (PubChem CID 113249741) has the molecular formula C21H25BN2O2S and a molecular weight of 380.32 g/mol. Its IUPAC name is 6-methyl-2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylsulfanyl]-1H-benzimidazole.
| Compound Name | 6-methyl-2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylsulfanyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 113249741 |
| Molecular Formula | C21H25BN2O2S |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 6-methyl-2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylsulfanyl]-1H-benzimidazole |
| SMILES | Cc1ccc2nc(SCc3ccc(B4OC(C)(C)C(C)(C)O4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C21H25BN2O2S/c1-14-6-11-17-18(12-14)24-19(23-17)27-13-15-7-9-16(10-8-15)22-25-20(2,3)21(4,5)26-22/h6-12H,13H2,1-5H3,(H,23,24) |
| InChIKey | HGGANOOTDDNEQN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|