C15H8ClN5O3 — CID 11325315
4-chloro-6-nitro-2-phenyl-[1,2,4]triazolo[4,3-a]quinoxalin-1-one (PubChem CID 11325315) has the molecular formula C15H8ClN5O3 and a molecular weight of 341.71 g/mol. Its IUPAC name is 4-chloro-6-nitro-2-phenyl-[1,2,4]triazolo[4,3-a]quinoxalin-1-one.
| Compound Name | 4-chloro-6-nitro-2-phenyl-[1,2,4]triazolo[4,3-a]quinoxalin-1-one |
|---|---|
| PubChem CID | 11325315 |
| Molecular Formula | C15H8ClN5O3 |
| Molecular Weight | 341.71 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | 4-chloro-6-nitro-2-phenyl-[1,2,4]triazolo[4,3-a]quinoxalin-1-one |
| SMILES | O=c1n(-c2ccccc2)nc2c(Cl)nc3c([N+](=O)[O-])cccc3n12 |
| InChI | InChI=1S/C15H8ClN5O3/c16-13-14-18-20(9-5-2-1-3-6-9)15(22)19(14)10-7-4-8-11(21(23)24)12(10)17-13/h1-8H |
| InChIKey | KONYOQLDVDVQDM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 95.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.71 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|