C19H11N3O2 — CID 118198067
9-nitro-14,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2,4,6,8(13),9,11,15,17,19-decaene (PubChem CID 118198067) has the molecular formula C19H11N3O2 and a molecular weight of 313.32 g/mol. Its IUPAC name is 9-nitro-14,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2,4,6,8(13),9,11,15,17,19-decaene.
| Compound Name | 9-nitro-14,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2,4,6,8(13),9,11,15,17,19-decaene |
|---|---|
| PubChem CID | 118198067 |
| Molecular Formula | C19H11N3O2 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 9-nitro-14,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2,4,6,8(13),9,11,15,17,19-decaene |
| SMILES | O=[N+]([O-])c1cccc2c1c1ccccc1c1nc3ccccc3n21 |
| InChI | InChI=1S/C19H11N3O2/c23-22(24)17-11-5-10-16-18(17)12-6-1-2-7-13(12)19-20-14-8-3-4-9-15(14)21(16)19/h1-11H |
| InChIKey | DFFWEIOAJQFKCA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|