C13H15F2NO3 — CID 113253204
methyl 4-[(2,4-difluorophenyl)methyl]morpholine-3-carboxylate (PubChem CID 113253204) has the molecular formula C13H15F2NO3 and a molecular weight of 271.26 g/mol. Its IUPAC name is methyl 4-[(2,4-difluorophenyl)methyl]morpholine-3-carboxylate.
| Compound Name | methyl 4-[(2,4-difluorophenyl)methyl]morpholine-3-carboxylate |
|---|---|
| PubChem CID | 113253204 |
| Molecular Formula | C13H15F2NO3 |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | methyl 4-[(2,4-difluorophenyl)methyl]morpholine-3-carboxylate |
| SMILES | COC(=O)C1COCCN1Cc1ccc(F)cc1F |
| InChI | InChI=1S/C13H15F2NO3/c1-18-13(17)12-8-19-5-4-16(12)7-9-2-3-10(14)6-11(9)15/h2-3,6,12H,4-5,7-8H2,1H3 |
| InChIKey | DTJZOFWARLFEST-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |