C14H15FN2O3 — CID 115670726
methyl 4-[(5-cyano-2-fluorophenyl)methyl]morpholine-3-carboxylate (PubChem CID 115670726) has the molecular formula C14H15FN2O3 and a molecular weight of 278.28 g/mol. Its IUPAC name is methyl 4-[(5-cyano-2-fluorophenyl)methyl]morpholine-3-carboxylate.
| Compound Name | methyl 4-[(5-cyano-2-fluorophenyl)methyl]morpholine-3-carboxylate |
|---|---|
| PubChem CID | 115670726 |
| Molecular Formula | C14H15FN2O3 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | methyl 4-[(5-cyano-2-fluorophenyl)methyl]morpholine-3-carboxylate |
| SMILES | COC(=O)C1COCCN1Cc1cc(C#N)ccc1F |
| InChI | InChI=1S/C14H15FN2O3/c1-19-14(18)13-9-20-5-4-17(13)8-11-6-10(7-16)2-3-12(11)15/h2-3,6,13H,4-5,8-9H2,1H3 |
| InChIKey | WPBZDSIJPDPPOV-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |