C13H17NO6 — CID 115670655
methyl 4-[(2-methoxycarbonylfuran-3-yl)methyl]morpholine-3-carboxylate (PubChem CID 115670655) has the molecular formula C13H17NO6 and a molecular weight of 283.28 g/mol. Its IUPAC name is methyl 4-[(2-methoxycarbonylfuran-3-yl)methyl]morpholine-3-carboxylate.
| Compound Name | methyl 4-[(2-methoxycarbonylfuran-3-yl)methyl]morpholine-3-carboxylate |
|---|---|
| PubChem CID | 115670655 |
| Molecular Formula | C13H17NO6 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | methyl 4-[(2-methoxycarbonylfuran-3-yl)methyl]morpholine-3-carboxylate |
| SMILES | COC(=O)c1occc1CN1CCOCC1C(=O)OC |
| InChI | InChI=1S/C13H17NO6/c1-17-12(15)10-8-19-6-4-14(10)7-9-3-5-20-11(9)13(16)18-2/h3,5,10H,4,6-8H2,1-2H3 |
| InChIKey | QGSYLOGITPKSAF-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |