C13H25NO4S — CID 113254226
methyl 1-(2-tert-butylsulfonylethyl)-4-methylpyrrolidine-3-carboxylate (PubChem CID 113254226) has the molecular formula C13H25NO4S and a molecular weight of 291.41 g/mol. Its IUPAC name is methyl 1-(2-tert-butylsulfonylethyl)-4-methylpyrrolidine-3-carboxylate.
| Compound Name | methyl 1-(2-tert-butylsulfonylethyl)-4-methylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 113254226 |
| Molecular Formula | C13H25NO4S |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | methyl 1-(2-tert-butylsulfonylethyl)-4-methylpyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CN(CCS(=O)(=O)C(C)(C)C)CC1C |
| InChI | InChI=1S/C13H25NO4S/c1-10-8-14(9-11(10)12(15)18-5)6-7-19(16,17)13(2,3)4/h10-11H,6-9H2,1-5H3 |
| InChIKey | QKBXDMPUABGFRZ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |