C19H29NO4S — CID 11326090
tert-butyl N-[cyclohexyl-(4-methylphenyl)sulfonylmethyl]carbamate (PubChem CID 11326090) has the molecular formula C19H29NO4S and a molecular weight of 367.51 g/mol. Its IUPAC name is tert-butyl N-[cyclohexyl-(4-methylphenyl)sulfonylmethyl]carbamate.
| Compound Name | tert-butyl N-[cyclohexyl-(4-methylphenyl)sulfonylmethyl]carbamate |
|---|---|
| PubChem CID | 11326090 |
| Molecular Formula | C19H29NO4S |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | tert-butyl N-[cyclohexyl-(4-methylphenyl)sulfonylmethyl]carbamate |
| SMILES | Cc1ccc(S(=O)(=O)C(NC(=O)OC(C)(C)C)C2CCCCC2)cc1 |
| InChI | InChI=1S/C19H29NO4S/c1-14-10-12-16(13-11-14)25(22,23)17(15-8-6-5-7-9-15)20-18(21)24-19(2,3)4/h10-13,15,17H,5-9H2,1-4H3,(H,20,21) |
| InChIKey | FCIPEOFBJLKKGN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |