C22H29NO4S — CID 3418933
benzyl N-[1-(4-methylphenyl)sulfonylheptyl]carbamate (PubChem CID 3418933) has the molecular formula C22H29NO4S and a molecular weight of 403.54 g/mol. Its IUPAC name is benzyl N-[1-(4-methylphenyl)sulfonylheptyl]carbamate.
| Compound Name | benzyl N-[1-(4-methylphenyl)sulfonylheptyl]carbamate |
|---|---|
| PubChem CID | 3418933 |
| Molecular Formula | C22H29NO4S |
| Molecular Weight | 403.54 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | benzyl N-[1-(4-methylphenyl)sulfonylheptyl]carbamate |
| SMILES | CCCCCCC(NC(=O)OCc1ccccc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H29NO4S/c1-3-4-5-9-12-21(28(25,26)20-15-13-18(2)14-16-20)23-22(24)27-17-19-10-7-6-8-11-19/h6-8,10-11,13-16,21H,3-5,9,12,17H2,1-2H3,(H,23,24) |
| InChIKey | ZQGDYINMIMYNCY-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|