C21H27NO5S — CID 11640052
tert-butyl N-[2-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonylethyl]carbamate (PubChem CID 11640052) has the molecular formula C21H27NO5S and a molecular weight of 405.52 g/mol. Its IUPAC name is tert-butyl N-[2-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonylethyl]carbamate.
| Compound Name | tert-butyl N-[2-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonylethyl]carbamate |
|---|---|
| PubChem CID | 11640052 |
| Molecular Formula | C21H27NO5S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | tert-butyl N-[2-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonylethyl]carbamate |
| SMILES | COc1ccc(CC(NC(=O)OC(C)(C)C)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H27NO5S/c1-15-6-12-18(13-7-15)28(24,25)19(22-20(23)27-21(2,3)4)14-16-8-10-17(26-5)11-9-16/h6-13,19H,14H2,1-5H3,(H,22,23) |
| InChIKey | NVMLADKCHCGNFM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |