C15H26F3N3O5 — CID 11326614
(2R)-2-amino-4-methyl-N-[(2S)-1-(methylamino)-1-oxo-3-prop-2-enoxypropan-2-yl]pentanamide;2,2,2-trifluoroacetic acid (PubChem CID 11326614) has the molecular formula C15H26F3N3O5 and a molecular weight of 385.38 g/mol. Its IUPAC name is (2R)-2-amino-4-methyl-N-[(2S)-1-(methylamino)-1-oxo-3-prop-2-enoxypropan-2-yl]pentanamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2R)-2-amino-4-methyl-N-[(2S)-1-(methylamino)-1-oxo-3-prop-2-enoxypropan-2-yl]pentanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 11326614 |
| Molecular Formula | C15H26F3N3O5 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | (2R)-2-amino-4-methyl-N-[(2S)-1-(methylamino)-1-oxo-3-prop-2-enoxypropan-2-yl]pentanamide;2,2,2-trifluoroacetic acid |
| SMILES | C=CCOC[C@H](NC(=O)[C@H](N)CC(C)C)C(=O)NC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H25N3O3.C2HF3O2/c1-5-6-19-8-11(13(18)15-4)16-12(17)10(14)7-9(2)3;3-2(4,5)1(6)7/h5,9-11H,1,6-8,14H2,2-4H3,(H,15,18)(H,16,17);(H,6,7)/t10-,11+;/m1./s1 |
| InChIKey | KZZZQFNAPVCJDO-DHXVBOOMSA-N |
| XLogP | 0.43 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|