C25H36O4 — CID 11327056
(E,4R,7R,8R)-7-(methoxymethoxy)-4,6,8-trimethyl-13-phenylmethoxytridec-5-en-9-yn-2-one (PubChem CID 11327056) has the molecular formula C25H36O4 and a molecular weight of 400.56 g/mol. Its IUPAC name is (E,4R,7R,8R)-7-(methoxymethoxy)-4,6,8-trimethyl-13-phenylmethoxytridec-5-en-9-yn-2-one.
| Compound Name | (E,4R,7R,8R)-7-(methoxymethoxy)-4,6,8-trimethyl-13-phenylmethoxytridec-5-en-9-yn-2-one |
|---|---|
| PubChem CID | 11327056 |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | (E,4R,7R,8R)-7-(methoxymethoxy)-4,6,8-trimethyl-13-phenylmethoxytridec-5-en-9-yn-2-one |
| SMILES | COCO[C@@H](/C(C)=C/[C@H](C)CC(C)=O)[C@H](C)C#CCCCOCc1ccccc1 |
| InChI | InChI=1S/C25H36O4/c1-20(17-23(4)26)16-22(3)25(29-19-27-5)21(2)12-8-7-11-15-28-18-24-13-9-6-10-14-24/h6,9-10,13-14,16,20-21,25H,7,11,15,17-19H2,1-5H3/b22-16+/t20-,21+,25+/m0/s1 |
| InChIKey | OPBSYOJZUOSVNP-HDOBTFFZSA-N |
| XLogP | 5.17 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|