C14H20ClNO2 — CID 113272106
N-(2-chloro-3-methoxypropyl)-2-(2,5-dimethylphenyl)acetamide (PubChem CID 113272106) has the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. Its IUPAC name is N-(2-chloro-3-methoxypropyl)-2-(2,5-dimethylphenyl)acetamide.
| Compound Name | N-(2-chloro-3-methoxypropyl)-2-(2,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 113272106 |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.77 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-(2-chloro-3-methoxypropyl)-2-(2,5-dimethylphenyl)acetamide |
| SMILES | COCC(Cl)CNC(=O)Cc1cc(C)ccc1C |
| InChI | InChI=1S/C14H20ClNO2/c1-10-4-5-11(2)12(6-10)7-14(17)16-8-13(15)9-18-3/h4-6,13H,7-9H2,1-3H3,(H,16,17) |
| InChIKey | BXNAQFHXQCZICW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.77 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|