C13H20ClNO — CID 65023585
2-chloro-N-[(2,5-dimethylphenyl)methyl]-3-methoxypropan-1-amine (PubChem CID 65023585) has the molecular formula C13H20ClNO and a molecular weight of 241.76 g/mol. Its IUPAC name is 2-chloro-N-[(2,5-dimethylphenyl)methyl]-3-methoxypropan-1-amine.
| Compound Name | 2-chloro-N-[(2,5-dimethylphenyl)methyl]-3-methoxypropan-1-amine |
|---|---|
| PubChem CID | 65023585 |
| Molecular Formula | C13H20ClNO |
| Molecular Weight | 241.76 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 2-chloro-N-[(2,5-dimethylphenyl)methyl]-3-methoxypropan-1-amine |
| SMILES | COCC(Cl)CNCc1cc(C)ccc1C |
| InChI | InChI=1S/C13H20ClNO/c1-10-4-5-11(2)12(6-10)7-15-8-13(14)9-16-3/h4-6,13,15H,7-9H2,1-3H3 |
| InChIKey | BVMSTDPXMJNONM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.76 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|