C14H26ClNO2 — CID 113273356
N-[3-(chloromethyl)pentan-3-yl]-2,4,5-trimethyloxolane-3-carboxamide (PubChem CID 113273356) has the molecular formula C14H26ClNO2 and a molecular weight of 275.82 g/mol. Its IUPAC name is N-[3-(chloromethyl)pentan-3-yl]-2,4,5-trimethyloxolane-3-carboxamide.
| Compound Name | N-[3-(chloromethyl)pentan-3-yl]-2,4,5-trimethyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 113273356 |
| Molecular Formula | C14H26ClNO2 |
| Molecular Weight | 275.82 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | N-[3-(chloromethyl)pentan-3-yl]-2,4,5-trimethyloxolane-3-carboxamide |
| SMILES | CCC(CC)(CCl)NC(=O)C1C(C)OC(C)C1C |
| InChI | InChI=1S/C14H26ClNO2/c1-6-14(7-2,8-15)16-13(17)12-9(3)10(4)18-11(12)5/h9-12H,6-8H2,1-5H3,(H,16,17) |
| InChIKey | IQDJTCBPEJHDCA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.82 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|