C13H23Cl2NO — CID 107867488
N-[1-chloro-2-(chloromethyl)butan-2-yl]-2,2,3,3-tetramethylcyclopropane-1-carboxamide (PubChem CID 107867488) has the molecular formula C13H23Cl2NO and a molecular weight of 280.24 g/mol. Its IUPAC name is N-[1-chloro-2-(chloromethyl)butan-2-yl]-2,2,3,3-tetramethylcyclopropane-1-carboxamide.
| Compound Name | N-[1-chloro-2-(chloromethyl)butan-2-yl]-2,2,3,3-tetramethylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 107867488 |
| Molecular Formula | C13H23Cl2NO |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | N-[1-chloro-2-(chloromethyl)butan-2-yl]-2,2,3,3-tetramethylcyclopropane-1-carboxamide |
| SMILES | CCC(CCl)(CCl)NC(=O)C1C(C)(C)C1(C)C |
| InChI | InChI=1S/C13H23Cl2NO/c1-6-13(7-14,8-15)16-10(17)9-11(2,3)12(9,4)5/h9H,6-8H2,1-5H3,(H,16,17) |
| InChIKey | PELMNOOIAZVQBL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|