C13H16BrNO4 — CID 113274368
N-[2-(2-bromoethoxy)ethyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 113274368) has the molecular formula C13H16BrNO4 and a molecular weight of 330.18 g/mol. Its IUPAC name is N-[2-(2-bromoethoxy)ethyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | N-[2-(2-bromoethoxy)ethyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 113274368 |
| Molecular Formula | C13H16BrNO4 |
| Molecular Weight | 330.18 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | N-[2-(2-bromoethoxy)ethyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | O=C(NCCOCCBr)C1COc2ccccc2O1 |
| InChI | InChI=1S/C13H16BrNO4/c14-5-7-17-8-6-15-13(16)12-9-18-10-3-1-2-4-11(10)19-12/h1-4,12H,5-9H2,(H,15,16) |
| InChIKey | ODCJPBAQBQTBDX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.18 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|