C18H25NO4 — CID 129380053
(3S)-N-(2-cycloheptyloxyethyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 129380053) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is (3S)-N-(2-cycloheptyloxyethyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | (3S)-N-(2-cycloheptyloxyethyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 129380053 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | (3S)-N-(2-cycloheptyloxyethyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | O=C(NCCOC1CCCCCC1)[C@@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C18H25NO4/c20-18(17-13-22-15-9-5-6-10-16(15)23-17)19-11-12-21-14-7-3-1-2-4-8-14/h5-6,9-10,14,17H,1-4,7-8,11-13H2,(H,19,20)/t17-/m0/s1 |
| InChIKey | BPOLPOFJAGRGBH-KRWDZBQOSA-N |
| XLogP | 2.68 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|