About (5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)-(1-methylpyrazol-4-yl)methanamine
(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)-(1-methylpyrazol-4-yl)methanamine (PubChem CID 113279600) has the molecular formula C12H14N6
and a molecular weight of 242.29 g/mol. Its IUPAC name is (5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)-(1-methylpyrazol-4-yl)methanamine.
Molecular Properties
| Compound Name | (5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)-(1-methylpyrazol-4-yl)methanamine |
| PubChem CID | 113279600 |
| Molecular Formula | C12H14N6 |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | (5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)-(1-methylpyrazol-4-yl)methanamine |
| SMILES | Cc1ccc2[nH]c(C(N)c3cnn(C)c3)nc2n1 |
| InChI | InChI=1S/C12H14N6/c1-7-3-4-9-11(15-7)17-12(16-9)10(13)8-5-14-18(2)6-8/h3-6,10H,13H2,1-2H3,(H,15,16,17) |
| InChIKey | RRMCRRZJGKFXET-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)-(1-methylpyrazol-4-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)-(1-methylpyrazol-4-yl)methanamine?
The IUPAC name of (5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)-(1-methylpyrazol-4-yl)methanamine (CID 113279600) is (5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)-(1-methylpyrazol-4-yl)methanamine.
What is the SMILES notation for (5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)-(1-methylpyrazol-4-yl)methanamine?
The canonical SMILES for (5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)-(1-methylpyrazol-4-yl)methanamine is Cc1ccc2[nH]c(C(N)c3cnn(C)c3)nc2n1.
What is the InChIKey of (5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)-(1-methylpyrazol-4-yl)methanamine?
The InChIKey is RRMCRRZJGKFXET-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N6/c1-7-3-4-9-11(15-7)17-12(16-9)10(13)8-5-14-18(2)6-8/h3-6,10H,13H2,1-2H3,(H,15,16,17).
What are the key properties of (5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)-(1-methylpyrazol-4-yl)methanamine?
(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)-(1-methylpyrazol-4-yl)methanamine has a molecular weight of 242.29 g/mol, XLogP of 1.05, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)-(1-methylpyrazol-4-yl)methanamine is sourced from PubChem (CID 113279600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).