C10H11N7 — CID 114402069
(1-methylpyrazol-4-yl)-(7H-purin-8-yl)methanamine (PubChem CID 114402069) has the molecular formula C10H11N7 and a molecular weight of 229.25 g/mol. Its IUPAC name is (1-methylpyrazol-4-yl)-(7H-purin-8-yl)methanamine.
| Compound Name | (1-methylpyrazol-4-yl)-(7H-purin-8-yl)methanamine |
|---|---|
| PubChem CID | 114402069 |
| Molecular Formula | C10H11N7 |
| Molecular Weight | 229.25 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | (1-methylpyrazol-4-yl)-(7H-purin-8-yl)methanamine |
| SMILES | Cn1cc(C(N)c2nc3ncncc3[nH]2)cn1 |
| InChI | InChI=1S/C10H11N7/c1-17-4-6(2-14-17)8(11)10-15-7-3-12-5-13-9(7)16-10/h2-5,8H,11H2,1H3,(H,12,13,15,16) |
| InChIKey | PTNRIXLDGCVOOX-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.25 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |