C21H17ClF3N5O — CID 11328337
1-(4-chlorophenyl)-9-methyl-2-[2-[4-(trifluoromethyl)phenyl]ethylamino]purin-6-one (PubChem CID 11328337) has the molecular formula C21H17ClF3N5O and a molecular weight of 447.85 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-9-methyl-2-[2-[4-(trifluoromethyl)phenyl]ethylamino]purin-6-one.
| Compound Name | 1-(4-chlorophenyl)-9-methyl-2-[2-[4-(trifluoromethyl)phenyl]ethylamino]purin-6-one |
|---|---|
| PubChem CID | 11328337 |
| Molecular Formula | C21H17ClF3N5O |
| Molecular Weight | 447.85 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 1-(4-chlorophenyl)-9-methyl-2-[2-[4-(trifluoromethyl)phenyl]ethylamino]purin-6-one |
| SMILES | Cn1cnc2c(=O)n(-c3ccc(Cl)cc3)c(NCCc3ccc(C(F)(F)F)cc3)nc21 |
| InChI | InChI=1S/C21H17ClF3N5O/c1-29-12-27-17-18(29)28-20(30(19(17)31)16-8-6-15(22)7-9-16)26-11-10-13-2-4-14(5-3-13)21(23,24)25/h2-9,12H,10-11H2,1H3,(H,26,28) |
| InChIKey | IQADYGPRZBNJHW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.85 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |