C26H18ClF3N4OS — CID 11156771
1-(4-chlorophenyl)-9-phenyl-2-[2-[4-(trifluoromethyl)phenyl]ethylsulfanyl]purin-6-one (PubChem CID 11156771) has the molecular formula C26H18ClF3N4OS and a molecular weight of 526.97 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-9-phenyl-2-[2-[4-(trifluoromethyl)phenyl]ethylsulfanyl]purin-6-one.
| Compound Name | 1-(4-chlorophenyl)-9-phenyl-2-[2-[4-(trifluoromethyl)phenyl]ethylsulfanyl]purin-6-one |
|---|---|
| PubChem CID | 11156771 |
| Molecular Formula | C26H18ClF3N4OS |
| Molecular Weight | 526.97 g/mol |
| Exact Mass | 526.08 |
| IUPAC Name | 1-(4-chlorophenyl)-9-phenyl-2-[2-[4-(trifluoromethyl)phenyl]ethylsulfanyl]purin-6-one |
| SMILES | O=c1c2ncn(-c3ccccc3)c2nc(SCCc2ccc(C(F)(F)F)cc2)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H18ClF3N4OS/c27-19-10-12-21(13-11-19)34-24(35)22-23(33(16-31-22)20-4-2-1-3-5-20)32-25(34)36-15-14-17-6-8-18(9-7-17)26(28,29)30/h1-13,16H,14-15H2 |
| InChIKey | KQGAZOPNBZHLNA-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.97 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |