C29H18ClFN4O — CID 174535981
1-(4-chlorophenyl)-2-(3-fluoro-4-phenylphenyl)-9-phenylpurin-6-one (PubChem CID 174535981) has the molecular formula C29H18ClFN4O and a molecular weight of 492.94 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-(3-fluoro-4-phenylphenyl)-9-phenylpurin-6-one.
| Compound Name | 1-(4-chlorophenyl)-2-(3-fluoro-4-phenylphenyl)-9-phenylpurin-6-one |
|---|---|
| PubChem CID | 174535981 |
| Molecular Formula | C29H18ClFN4O |
| Molecular Weight | 492.94 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | 1-(4-chlorophenyl)-2-(3-fluoro-4-phenylphenyl)-9-phenylpurin-6-one |
| SMILES | O=c1c2ncn(-c3ccccc3)c2nc(-c2ccc(-c3ccccc3)c(F)c2)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H18ClFN4O/c30-21-12-14-23(15-13-21)35-27(20-11-16-24(25(31)17-20)19-7-3-1-4-8-19)33-28-26(29(35)36)32-18-34(28)22-9-5-2-6-10-22/h1-18H |
| InChIKey | WLWLQERKPIKPOE-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.94 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |