C16H13F5N4OS — CID 69438844
1-(3,4-difluorophenyl)-9-methyl-2-(4,4,4-trifluorobutylsulfanyl)purin-6-one (PubChem CID 69438844) has the molecular formula C16H13F5N4OS and a molecular weight of 404.36 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-9-methyl-2-(4,4,4-trifluorobutylsulfanyl)purin-6-one.
| Compound Name | 1-(3,4-difluorophenyl)-9-methyl-2-(4,4,4-trifluorobutylsulfanyl)purin-6-one |
|---|---|
| PubChem CID | 69438844 |
| Molecular Formula | C16H13F5N4OS |
| Molecular Weight | 404.36 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 1-(3,4-difluorophenyl)-9-methyl-2-(4,4,4-trifluorobutylsulfanyl)purin-6-one |
| SMILES | Cn1cnc2c(=O)n(-c3ccc(F)c(F)c3)c(SCCCC(F)(F)F)nc21 |
| InChI | InChI=1S/C16H13F5N4OS/c1-24-8-22-12-13(24)23-15(27-6-2-5-16(19,20)21)25(14(12)26)9-3-4-10(17)11(18)7-9/h3-4,7-8H,2,5-6H2,1H3 |
| InChIKey | UCLJKICFHRIXDW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|