C12H9ClF2N4OS — CID 87320853
1-(3,4-difluorophenyl)-9-methyl-2-sulfanylidene-3H-purin-6-one;hydrochloride (PubChem CID 87320853) has the molecular formula C12H9ClF2N4OS and a molecular weight of 330.75 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-9-methyl-2-sulfanylidene-3H-purin-6-one;hydrochloride.
| Compound Name | 1-(3,4-difluorophenyl)-9-methyl-2-sulfanylidene-3H-purin-6-one;hydrochloride |
|---|---|
| PubChem CID | 87320853 |
| Molecular Formula | C12H9ClF2N4OS |
| Molecular Weight | 330.75 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | 1-(3,4-difluorophenyl)-9-methyl-2-sulfanylidene-3H-purin-6-one;hydrochloride |
| SMILES | Cl.Cn1cnc2c(=O)n(-c3ccc(F)c(F)c3)c(=S)[nH]c21 |
| InChI | InChI=1S/C12H8F2N4OS.ClH/c1-17-5-15-9-10(17)16-12(20)18(11(9)19)6-2-3-7(13)8(14)4-6;/h2-5H,1H3,(H,16,20);1H |
| InChIKey | LBTDNJWNAWLYBR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 55.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.75 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|