C10H6FN5O2S2 — CID 178171333
6-(5-fluoro-6-methoxy-3-pyridinyl)-5-sulfanylidene-4H-thiadiazolo[4,5-d]pyrimidin-7-one (PubChem CID 178171333) has the molecular formula C10H6FN5O2S2 and a molecular weight of 311.32 g/mol. Its IUPAC name is 6-(5-fluoro-6-methoxy-3-pyridinyl)-5-sulfanylidene-4H-thiadiazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 6-(5-fluoro-6-methoxy-3-pyridinyl)-5-sulfanylidene-4H-thiadiazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 178171333 |
| Molecular Formula | C10H6FN5O2S2 |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 310.99 |
| IUPAC Name | 6-(5-fluoro-6-methoxy-3-pyridinyl)-5-sulfanylidene-4H-thiadiazolo[4,5-d]pyrimidin-7-one |
| SMILES | COc1ncc(-n2c(=S)[nH]c3nnsc3c2=O)cc1F |
| InChI | InChI=1S/C10H6FN5O2S2/c1-18-8-5(11)2-4(3-12-8)16-9(17)6-7(13-10(16)19)14-15-20-6/h2-3H,1H3,(H,13,19) |
| InChIKey | MJFAHHWVDXBDSW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|