C19H16F3N3O2 — CID 144991035
5-fluoro-1-(5-fluoro-6-methoxy-3-pyridinyl)-2-(3-fluoro-4-propylphenyl)imidazole-4-carbaldehyde (PubChem CID 144991035) has the molecular formula C19H16F3N3O2 and a molecular weight of 375.35 g/mol. Its IUPAC name is 5-fluoro-1-(5-fluoro-6-methoxy-3-pyridinyl)-2-(3-fluoro-4-propylphenyl)imidazole-4-carbaldehyde.
| Compound Name | 5-fluoro-1-(5-fluoro-6-methoxy-3-pyridinyl)-2-(3-fluoro-4-propylphenyl)imidazole-4-carbaldehyde |
|---|---|
| PubChem CID | 144991035 |
| Molecular Formula | C19H16F3N3O2 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 5-fluoro-1-(5-fluoro-6-methoxy-3-pyridinyl)-2-(3-fluoro-4-propylphenyl)imidazole-4-carbaldehyde |
| SMILES | CCCc1ccc(-c2nc(C=O)c(F)n2-c2cnc(OC)c(F)c2)cc1F |
| InChI | InChI=1S/C19H16F3N3O2/c1-3-4-11-5-6-12(7-14(11)20)18-24-16(10-26)17(22)25(18)13-8-15(21)19(27-2)23-9-13/h5-10H,3-4H2,1-2H3 |
| InChIKey | LHZVZHDRVCDESB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|