C13H9N5OS — CID 87321096
4-(9-methyl-6-oxo-2-sulfanylidene-3H-purin-1-yl)benzonitrile (PubChem CID 87321096) has the molecular formula C13H9N5OS and a molecular weight of 283.32 g/mol. Its IUPAC name is 4-(9-methyl-6-oxo-2-sulfanylidene-3H-purin-1-yl)benzonitrile.
| Compound Name | 4-(9-methyl-6-oxo-2-sulfanylidene-3H-purin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 87321096 |
| Molecular Formula | C13H9N5OS |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 4-(9-methyl-6-oxo-2-sulfanylidene-3H-purin-1-yl)benzonitrile |
| SMILES | Cn1cnc2c(=O)n(-c3ccc(C#N)cc3)c(=S)[nH]c21 |
| InChI | InChI=1S/C13H9N5OS/c1-17-7-15-10-11(17)16-13(20)18(12(10)19)9-4-2-8(6-14)3-5-9/h2-5,7H,1H3,(H,16,20) |
| InChIKey | KFVHYZRMIXOGBV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 79.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|