C29H30O5 — CID 11328614
ethyl (1'R,3E,6'R,8'R)-3-benzylidene-6'-methyl-7'-oxospiro[1,2-dihydronaphthalene-4,9'-10,11-dioxatricyclo[6.2.1.01,6]undecane]-8'-carboxylate (PubChem CID 11328614) has the molecular formula C29H30O5 and a molecular weight of 458.55 g/mol. Its IUPAC name is ethyl (1'R,3E,6'R,8'R)-3-benzylidene-6'-methyl-7'-oxospiro[1,2-dihydronaphthalene-4,9'-10,11-dioxatricyclo[6.2.1.01,6]undecane]-8'-carboxylate.
| Compound Name | ethyl (1'R,3E,6'R,8'R)-3-benzylidene-6'-methyl-7'-oxospiro[1,2-dihydronaphthalene-4,9'-10,11-dioxatricyclo[6.2.1.01,6]undecane]-8'-carboxylate |
|---|---|
| PubChem CID | 11328614 |
| Molecular Formula | C29H30O5 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | ethyl (1'R,3E,6'R,8'R)-3-benzylidene-6'-methyl-7'-oxospiro[1,2-dihydronaphthalene-4,9'-10,11-dioxatricyclo[6.2.1.01,6]undecane]-8'-carboxylate |
| SMILES | CCOC(=O)[C@]12O[C@@]3(CCCC[C@]3(C)C1=O)OC21/C(=C/c2ccccc2)CCc2ccccc21 |
| InChI | InChI=1S/C29H30O5/c1-3-32-25(31)29-24(30)26(2)17-9-10-18-27(26,34-29)33-28(29)22(19-20-11-5-4-6-12-20)16-15-21-13-7-8-14-23(21)28/h4-8,11-14,19H,3,9-10,15-18H2,1-2H3/b22-19+/t26-,27-,28?,29-/m1/s1 |
| InChIKey | VCDXKIYMKFQPPC-FDUCPYPTSA-N |
| XLogP | 5.12 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|