C19H18O4 — CID 11289864
(1S,6R,8R)-6-methylspiro[10,11-dioxatricyclo[6.2.1.01,6]undecane-9,4'-naphthalene]-1',7-dione (PubChem CID 11289864) has the molecular formula C19H18O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is (1S,6R,8R)-6-methylspiro[10,11-dioxatricyclo[6.2.1.01,6]undecane-9,4'-naphthalene]-1',7-dione.
| Compound Name | (1S,6R,8R)-6-methylspiro[10,11-dioxatricyclo[6.2.1.01,6]undecane-9,4'-naphthalene]-1',7-dione |
|---|---|
| PubChem CID | 11289864 |
| Molecular Formula | C19H18O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | (1S,6R,8R)-6-methylspiro[10,11-dioxatricyclo[6.2.1.01,6]undecane-9,4'-naphthalene]-1',7-dione |
| SMILES | C[C@]12CCCC[C@@]13O[C@@H](C2=O)C1(C=CC(=O)c2ccccc21)O3 |
| InChI | InChI=1S/C19H18O4/c1-17-9-4-5-10-19(17)22-16(15(17)21)18(23-19)11-8-14(20)12-6-2-3-7-13(12)18/h2-3,6-8,11,16H,4-5,9-10H2,1H3/t16-,17+,18?,19-/m0/s1 |
| InChIKey | KTSCXAWBYNICGU-SWDXFRIISA-N |
| XLogP | 2.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |