C12H15N3O3 — CID 113290579
3-(4-aminophenyl)-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]propanamide (PubChem CID 113290579) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is 3-(4-aminophenyl)-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]propanamide.
| Compound Name | 3-(4-aminophenyl)-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]propanamide |
|---|---|
| PubChem CID | 113290579 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 3-(4-aminophenyl)-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]propanamide |
| SMILES | Nc1ccc(CCC(=O)N[C@@H]2CONC2=O)cc1 |
| InChI | InChI=1S/C12H15N3O3/c13-9-4-1-8(2-5-9)3-6-11(16)14-10-7-18-15-12(10)17/h1-2,4-5,10H,3,6-7,13H2,(H,14,16)(H,15,17)/t10-/m1/s1 |
| InChIKey | JMDCIEAHQWPBGG-SNVBAGLBSA-N |
| XLogP | -0.25 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|