C14H23N3O — CID 113291145
1-(1-cyclopentylpyrazol-3-yl)-4-(dimethylamino)butan-2-one (PubChem CID 113291145) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is 1-(1-cyclopentylpyrazol-3-yl)-4-(dimethylamino)butan-2-one.
| Compound Name | 1-(1-cyclopentylpyrazol-3-yl)-4-(dimethylamino)butan-2-one |
|---|---|
| PubChem CID | 113291145 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 1-(1-cyclopentylpyrazol-3-yl)-4-(dimethylamino)butan-2-one |
| SMILES | CN(C)CCC(=O)Cc1ccn(C2CCCC2)n1 |
| InChI | InChI=1S/C14H23N3O/c1-16(2)9-8-14(18)11-12-7-10-17(15-12)13-5-3-4-6-13/h7,10,13H,3-6,8-9,11H2,1-2H3 |
| InChIKey | BJDNORZUURSPSI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |