C13H17F3N2O — CID 79952722
1-(1-cyclopentylpyrazol-3-yl)-5,5,5-trifluoropentan-2-one (PubChem CID 79952722) has the molecular formula C13H17F3N2O and a molecular weight of 274.29 g/mol. Its IUPAC name is 1-(1-cyclopentylpyrazol-3-yl)-5,5,5-trifluoropentan-2-one.
| Compound Name | 1-(1-cyclopentylpyrazol-3-yl)-5,5,5-trifluoropentan-2-one |
|---|---|
| PubChem CID | 79952722 |
| Molecular Formula | C13H17F3N2O |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 1-(1-cyclopentylpyrazol-3-yl)-5,5,5-trifluoropentan-2-one |
| SMILES | O=C(CCC(F)(F)F)Cc1ccn(C2CCCC2)n1 |
| InChI | InChI=1S/C13H17F3N2O/c14-13(15,16)7-5-12(19)9-10-6-8-18(17-10)11-3-1-2-4-11/h6,8,11H,1-5,7,9H2 |
| InChIKey | SRENJZVMHQYWGI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |