C18H30N2O — CID 114975039
1-(1-cyclohexylpyrazol-3-yl)-4,5,5-trimethylhexan-2-one (PubChem CID 114975039) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is 1-(1-cyclohexylpyrazol-3-yl)-4,5,5-trimethylhexan-2-one.
| Compound Name | 1-(1-cyclohexylpyrazol-3-yl)-4,5,5-trimethylhexan-2-one |
|---|---|
| PubChem CID | 114975039 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | 1-(1-cyclohexylpyrazol-3-yl)-4,5,5-trimethylhexan-2-one |
| SMILES | CC(CC(=O)Cc1ccn(C2CCCCC2)n1)C(C)(C)C |
| InChI | InChI=1S/C18H30N2O/c1-14(18(2,3)4)12-17(21)13-15-10-11-20(19-15)16-8-6-5-7-9-16/h10-11,14,16H,5-9,12-13H2,1-4H3 |
| InChIKey | LAIHPEVOJVABNF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |