C13H15N3O2S — CID 113297957
2-[2-[3-(dimethylamino)anilino]-1,3-thiazol-4-yl]acetic acid (PubChem CID 113297957) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is 2-[2-[3-(dimethylamino)anilino]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[3-(dimethylamino)anilino]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 113297957 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 2-[2-[3-(dimethylamino)anilino]-1,3-thiazol-4-yl]acetic acid |
| SMILES | CN(C)c1cccc(Nc2nc(CC(=O)O)cs2)c1 |
| InChI | InChI=1S/C13H15N3O2S/c1-16(2)11-5-3-4-9(6-11)14-13-15-10(8-19-13)7-12(17)18/h3-6,8H,7H2,1-2H3,(H,14,15)(H,17,18) |
| InChIKey | PBMXNZYUANDQCD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |