C10H9BrN2O2S2 — CID 113298169
(5E)-3-(2-aminoethyl)-5-[(3-bromothiophen-2-yl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 113298169) has the molecular formula C10H9BrN2O2S2 and a molecular weight of 333.23 g/mol. Its IUPAC name is (5E)-3-(2-aminoethyl)-5-[(3-bromothiophen-2-yl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-(2-aminoethyl)-5-[(3-bromothiophen-2-yl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 113298169 |
| Molecular Formula | C10H9BrN2O2S2 |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 331.93 |
| IUPAC Name | (5E)-3-(2-aminoethyl)-5-[(3-bromothiophen-2-yl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | NCCN1C(=O)S/C(=C/c2sccc2Br)C1=O |
| InChI | InChI=1S/C10H9BrN2O2S2/c11-6-1-4-16-7(6)5-8-9(14)13(3-2-12)10(15)17-8/h1,4-5H,2-3,12H2/b8-5+ |
| InChIKey | JFNCCYYASGFACE-VMPITWQZSA-N |
| XLogP | 2.51 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|