C12H10F2N2O2S — CID 43312714
(5Z)-3-(2-aminoethyl)-5-[(2,5-difluorophenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 43312714) has the molecular formula C12H10F2N2O2S and a molecular weight of 284.29 g/mol. Its IUPAC name is (5Z)-3-(2-aminoethyl)-5-[(2,5-difluorophenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-(2-aminoethyl)-5-[(2,5-difluorophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 43312714 |
| Molecular Formula | C12H10F2N2O2S |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | (5Z)-3-(2-aminoethyl)-5-[(2,5-difluorophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | NCCN1C(=O)S/C(=C\c2cc(F)ccc2F)C1=O |
| InChI | InChI=1S/C12H10F2N2O2S/c13-8-1-2-9(14)7(5-8)6-10-11(17)16(4-3-15)12(18)19-10/h1-2,5-6H,3-4,15H2/b10-6- |
| InChIKey | LGJVQALEXINLDM-POHAHGRESA-N |
| XLogP | 1.96 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|