C13H20OS3 — CID 113299434
1-(3-ethyl-1,4-dithian-2-yl)-3-thiophen-3-ylpropan-1-ol (PubChem CID 113299434) has the molecular formula C13H20OS3 and a molecular weight of 288.50 g/mol. Its IUPAC name is 1-(3-ethyl-1,4-dithian-2-yl)-3-thiophen-3-ylpropan-1-ol.
| Compound Name | 1-(3-ethyl-1,4-dithian-2-yl)-3-thiophen-3-ylpropan-1-ol |
|---|---|
| PubChem CID | 113299434 |
| Molecular Formula | C13H20OS3 |
| Molecular Weight | 288.50 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 1-(3-ethyl-1,4-dithian-2-yl)-3-thiophen-3-ylpropan-1-ol |
| SMILES | CCC1SCCSC1C(O)CCc1ccsc1 |
| InChI | InChI=1S/C13H20OS3/c1-2-12-13(17-8-7-16-12)11(14)4-3-10-5-6-15-9-10/h5-6,9,11-14H,2-4,7-8H2,1H3 |
| InChIKey | DADVYJAQKSRRKQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |