C13H20ClN3O — CID 113301930
3-(chloromethyl)-4-cyclopropyl-5-(2,4,5-trimethyloxolan-3-yl)-1,2,4-triazole (PubChem CID 113301930) has the molecular formula C13H20ClN3O and a molecular weight of 269.78 g/mol. Its IUPAC name is 3-(chloromethyl)-4-cyclopropyl-5-(2,4,5-trimethyloxolan-3-yl)-1,2,4-triazole.
| Compound Name | 3-(chloromethyl)-4-cyclopropyl-5-(2,4,5-trimethyloxolan-3-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 113301930 |
| Molecular Formula | C13H20ClN3O |
| Molecular Weight | 269.78 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 3-(chloromethyl)-4-cyclopropyl-5-(2,4,5-trimethyloxolan-3-yl)-1,2,4-triazole |
| SMILES | CC1OC(C)C(c2nnc(CCl)n2C2CC2)C1C |
| InChI | InChI=1S/C13H20ClN3O/c1-7-8(2)18-9(3)12(7)13-16-15-11(6-14)17(13)10-4-5-10/h7-10,12H,4-6H2,1-3H3 |
| InChIKey | MOQROCFRABPSMA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.78 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|