C9H11ClF3N3 — CID 115397746
3-(chloromethyl)-4-cyclopropyl-5-(3,3,3-trifluoropropyl)-1,2,4-triazole (PubChem CID 115397746) has the molecular formula C9H11ClF3N3 and a molecular weight of 253.65 g/mol. Its IUPAC name is 3-(chloromethyl)-4-cyclopropyl-5-(3,3,3-trifluoropropyl)-1,2,4-triazole.
| Compound Name | 3-(chloromethyl)-4-cyclopropyl-5-(3,3,3-trifluoropropyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 115397746 |
| Molecular Formula | C9H11ClF3N3 |
| Molecular Weight | 253.65 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 3-(chloromethyl)-4-cyclopropyl-5-(3,3,3-trifluoropropyl)-1,2,4-triazole |
| SMILES | FC(F)(F)CCc1nnc(CCl)n1C1CC1 |
| InChI | InChI=1S/C9H11ClF3N3/c10-5-8-15-14-7(3-4-9(11,12)13)16(8)6-1-2-6/h6H,1-5H2 |
| InChIKey | UHKGWXVHHHAARO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.65 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|