C8H10F3N3S — CID 115390486
4-cyclopropyl-3-(3,3,3-trifluoropropyl)-1H-1,2,4-triazole-5-thione (PubChem CID 115390486) has the molecular formula C8H10F3N3S and a molecular weight of 237.25 g/mol. Its IUPAC name is 4-cyclopropyl-3-(3,3,3-trifluoropropyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-cyclopropyl-3-(3,3,3-trifluoropropyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 115390486 |
| Molecular Formula | C8H10F3N3S |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 4-cyclopropyl-3-(3,3,3-trifluoropropyl)-1H-1,2,4-triazole-5-thione |
| SMILES | FC(F)(F)CCc1n[nH]c(=S)n1C1CC1 |
| InChI | InChI=1S/C8H10F3N3S/c9-8(10,11)4-3-6-12-13-7(15)14(6)5-1-2-5/h5H,1-4H2,(H,13,15) |
| InChIKey | OMRLNHDCDIZJHK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|