C11H15F3N4OS — CID 99812071
N-[2-(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-4,4,4-trifluorobutanamide (PubChem CID 99812071) has the molecular formula C11H15F3N4OS and a molecular weight of 308.33 g/mol. Its IUPAC name is N-[2-(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-4,4,4-trifluorobutanamide.
| Compound Name | N-[2-(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-4,4,4-trifluorobutanamide |
|---|---|
| PubChem CID | 99812071 |
| Molecular Formula | C11H15F3N4OS |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | N-[2-(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-4,4,4-trifluorobutanamide |
| SMILES | O=C(CCC(F)(F)F)NCCc1n[nH]c(=S)n1C1CC1 |
| InChI | InChI=1S/C11H15F3N4OS/c12-11(13,14)5-3-9(19)15-6-4-8-16-17-10(20)18(8)7-1-2-7/h7H,1-6H2,(H,15,19)(H,17,20) |
| InChIKey | BEJKVZYQBSRDRJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|