C14H24BrN3O — CID 113302276
3-(bromomethyl)-5-cyclooctyl-4-(2-methoxyethyl)-1,2,4-triazole (PubChem CID 113302276) has the molecular formula C14H24BrN3O and a molecular weight of 330.27 g/mol. Its IUPAC name is 3-(bromomethyl)-5-cyclooctyl-4-(2-methoxyethyl)-1,2,4-triazole.
| Compound Name | 3-(bromomethyl)-5-cyclooctyl-4-(2-methoxyethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 113302276 |
| Molecular Formula | C14H24BrN3O |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 3-(bromomethyl)-5-cyclooctyl-4-(2-methoxyethyl)-1,2,4-triazole |
| SMILES | COCCn1c(CBr)nnc1C1CCCCCCC1 |
| InChI | InChI=1S/C14H24BrN3O/c1-19-10-9-18-13(11-15)16-17-14(18)12-7-5-3-2-4-6-8-12/h12H,2-11H2,1H3 |
| InChIKey | XSGQXEGUUXMMLP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|