C10H16BrN3O3S — CID 113302283
3-[5-(bromomethyl)-4-(2-methoxyethyl)-1,2,4-triazol-3-yl]thiolane 1,1-dioxide (PubChem CID 113302283) has the molecular formula C10H16BrN3O3S and a molecular weight of 338.23 g/mol. Its IUPAC name is 3-[5-(bromomethyl)-4-(2-methoxyethyl)-1,2,4-triazol-3-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[5-(bromomethyl)-4-(2-methoxyethyl)-1,2,4-triazol-3-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 113302283 |
| Molecular Formula | C10H16BrN3O3S |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | 3-[5-(bromomethyl)-4-(2-methoxyethyl)-1,2,4-triazol-3-yl]thiolane 1,1-dioxide |
| SMILES | COCCn1c(CBr)nnc1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H16BrN3O3S/c1-17-4-3-14-9(6-11)12-13-10(14)8-2-5-18(15,16)7-8/h8H,2-7H2,1H3 |
| InChIKey | AQRFMBNINGXQBS-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|