C14H19N3 — CID 113303196
12-methyl-4-propan-2-yl-1,4,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene (PubChem CID 113303196) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is 12-methyl-4-propan-2-yl-1,4,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene.
| Compound Name | 12-methyl-4-propan-2-yl-1,4,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene |
|---|---|
| PubChem CID | 113303196 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 12-methyl-4-propan-2-yl-1,4,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene |
| SMILES | Cc1ccc2nc3c(n2c1)CN(C(C)C)CC3 |
| InChI | InChI=1S/C14H19N3/c1-10(2)16-7-6-12-13(9-16)17-8-11(3)4-5-14(17)15-12/h4-5,8,10H,6-7,9H2,1-3H3 |
| InChIKey | FIMWCULVMGMXPZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |